C22H22N6O2 — CID 123507857
4-methyl-2-[6-methyl-1-[2-(triazol-2-yl)benzoyl]piperidin-3-yl]oxypyridine-3-carbonitrile (PubChem CID 123507857) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 4-methyl-2-[6-methyl-1-[2-(triazol-2-yl)benzoyl]piperidin-3-yl]oxypyridine-3-carbonitrile.
| Compound Name | 4-methyl-2-[6-methyl-1-[2-(triazol-2-yl)benzoyl]piperidin-3-yl]oxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 123507857 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 4-methyl-2-[6-methyl-1-[2-(triazol-2-yl)benzoyl]piperidin-3-yl]oxypyridine-3-carbonitrile |
| SMILES | Cc1ccnc(OC2CCC(C)N(C(=O)c3ccccc3-n3nccn3)C2)c1C#N |
| InChI | InChI=1S/C22H22N6O2/c1-15-9-10-24-21(19(15)13-23)30-17-8-7-16(2)27(14-17)22(29)18-5-3-4-6-20(18)28-25-11-12-26-28/h3-6,9-12,16-17H,7-8,14H2,1-2H3 |
| InChIKey | AUZOCXXGCDWNIR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |