C24H33F3O4 — CID 123508155
4-[3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-5-oct-2-enylcyclopentane-1,3-diol (PubChem CID 123508155) has the molecular formula C24H33F3O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-[3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-5-oct-2-enylcyclopentane-1,3-diol.
| Compound Name | 4-[3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-5-oct-2-enylcyclopentane-1,3-diol |
|---|---|
| PubChem CID | 123508155 |
| Molecular Formula | C24H33F3O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 4-[3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-5-oct-2-enylcyclopentane-1,3-diol |
| SMILES | CCCCCC=CCC1C(O)CC(O)C1C=CC(O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H33F3O4/c1-2-3-4-5-6-7-11-20-21(23(30)15-22(20)29)13-12-18(28)16-31-19-10-8-9-17(14-19)24(25,26)27/h6-10,12-14,18,20-23,28-30H,2-5,11,15-16H2,1H3 |
| InChIKey | ZOAUMHFPBZTBJP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|