C23H40N3+3 — CID 123508403
ethyl-(7-ethylidene-4-hexyl-2-pentylimidazo[1,5-a]pyridine-2,4-diium-8-ylidene)-methylazanium (PubChem CID 123508403) has the molecular formula C23H40N3+3 and a molecular weight of 358.59 g/mol. Its IUPAC name is ethyl-(7-ethylidene-4-hexyl-2-pentylimidazo[1,5-a]pyridine-2,4-diium-8-ylidene)-methylazanium.
| Compound Name | ethyl-(7-ethylidene-4-hexyl-2-pentylimidazo[1,5-a]pyridine-2,4-diium-8-ylidene)-methylazanium |
|---|---|
| PubChem CID | 123508403 |
| Molecular Formula | C23H40N3+3 |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 358.32 |
| IUPAC Name | ethyl-(7-ethylidene-4-hexyl-2-pentylimidazo[1,5-a]pyridine-2,4-diium-8-ylidene)-methylazanium |
| SMILES | CC=C1C=C[N+]2(CCCCCC)C=[N+](CCCCC)C=C2/C1=[N+](\C)CC |
| InChI | InChI=1S/C23H40N3/c1-6-10-12-14-17-26-18-15-21(8-3)23(24(5)9-4)22(26)19-25(20-26)16-13-11-7-2/h8,15,18-20H,6-7,9-14,16-17H2,1-5H3/q+3/b21-8?,24-23+ |
| InChIKey | WPQRWZMIQPAQRH-JEKHKMMKSA-N |
| XLogP | 5.05 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|