About N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine
N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine (PubChem CID 123508619) has the molecular formula C15H18F3N3
and a molecular weight of 297.32 g/mol. Its IUPAC name is N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine.
Molecular Properties
| Compound Name | N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine |
| PubChem CID | 123508619 |
| Molecular Formula | C15H18F3N3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine |
| SMILES | CNC(C)C1=CC(C(F)(F)F)=CC(n2cnc(C)c2)=CC1 |
| InChI | InChI=1S/C15H18F3N3/c1-10-8-21(9-20-10)14-5-4-12(11(2)19-3)6-13(7-14)15(16,17)18/h5-9,11,19H,4H2,1-3H3 |
| InChIKey | NEGDQCCZTUTXNO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine?
The IUPAC name of N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine (CID 123508619) is N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine.
What is the SMILES notation for N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine?
The canonical SMILES for N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine is CNC(C)C1=CC(C(F)(F)F)=CC(n2cnc(C)c2)=CC1.
What is the InChIKey of N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine?
The InChIKey is NEGDQCCZTUTXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3N3/c1-10-8-21(9-20-10)14-5-4-12(11(2)19-3)6-13(7-14)15(16,17)18/h5-9,11,19H,4H2,1-3H3.
What are the key properties of N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine?
N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine has a molecular weight of 297.32 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[5-(4-methylimidazol-1-yl)-3-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]ethanamine is sourced from PubChem (CID 123508619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).