C21H24O5 — CID 123508693
[3-[(5S)-3,5-dimethylhepta-1,3-dienyl]-7-methyl-6,8-dioxoisochromen-7-yl] acetate (PubChem CID 123508693) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is [3-[(5S)-3,5-dimethylhepta-1,3-dienyl]-7-methyl-6,8-dioxoisochromen-7-yl] acetate.
| Compound Name | [3-[(5S)-3,5-dimethylhepta-1,3-dienyl]-7-methyl-6,8-dioxoisochromen-7-yl] acetate |
|---|---|
| PubChem CID | 123508693 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [3-[(5S)-3,5-dimethylhepta-1,3-dienyl]-7-methyl-6,8-dioxoisochromen-7-yl] acetate |
| SMILES | CC[C@H](C)C=C(C)C=CC1=CC2=CC(=O)C(C)(OC(C)=O)C(=O)C2=CO1 |
| InChI | InChI=1S/C21H24O5/c1-6-13(2)9-14(3)7-8-17-10-16-11-19(23)21(5,26-15(4)22)20(24)18(16)12-25-17/h7-13H,6H2,1-5H3/t13-,21?/m0/s1 |
| InChIKey | OLECGRIPMRAFQX-JRTLGTJJSA-N |
| XLogP | 3.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|