About tris[1,2,2-tris(methylsilyloxy)ethenyl]silane
tris[1,2,2-tris(methylsilyloxy)ethenyl]silane (PubChem CID 123509496) has the molecular formula C15H46O9Si10
and a molecular weight of 651.38 g/mol. Its IUPAC name is tris[1,2,2-tris(methylsilyloxy)ethenyl]silane.
Molecular Properties
| Compound Name | tris[1,2,2-tris(methylsilyloxy)ethenyl]silane |
| PubChem CID | 123509496 |
| Molecular Formula | C15H46O9Si10 |
| Molecular Weight | 651.38 g/mol |
| Exact Mass | 650.08 |
| IUPAC Name | tris[1,2,2-tris(methylsilyloxy)ethenyl]silane |
| SMILES | C[SiH2]OC(O[SiH2]C)=C(O[SiH2]C)[SiH](C(O[SiH2]C)=C(O[SiH2]C)O[SiH2]C)C(O[SiH2]C)=C(O[SiH2]C)O[SiH2]C |
| InChI | InChI=1S/C15H46O9Si10/c1-25-16-10(17-26-2)13(22-31-7)34(14(23-32-8)11(18-27-3)19-28-4)15(24-33-9)12(20-29-5)21-30-6/h34H,25-33H2,1-9H3 |
| InChIKey | FTOPTJXKZCDVKG-UHFFFAOYSA-N |
| XLogP | -3.33 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 651.38 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris[1,2,2-tris(methylsilyloxy)ethenyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[1,2,2-tris(methylsilyloxy)ethenyl]silane?
The IUPAC name of tris[1,2,2-tris(methylsilyloxy)ethenyl]silane (CID 123509496) is tris[1,2,2-tris(methylsilyloxy)ethenyl]silane.
What is the SMILES notation for tris[1,2,2-tris(methylsilyloxy)ethenyl]silane?
The canonical SMILES for tris[1,2,2-tris(methylsilyloxy)ethenyl]silane is C[SiH2]OC(O[SiH2]C)=C(O[SiH2]C)[SiH](C(O[SiH2]C)=C(O[SiH2]C)O[SiH2]C)C(O[SiH2]C)=C(O[SiH2]C)O[SiH2]C.
What is the InChIKey of tris[1,2,2-tris(methylsilyloxy)ethenyl]silane?
The InChIKey is FTOPTJXKZCDVKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H46O9Si10/c1-25-16-10(17-26-2)13(22-31-7)34(14(23-32-8)11(18-27-3)19-28-4)15(24-33-9)12(20-29-5)21-30-6/h34H,25-33H2,1-9H3.
What are the key properties of tris[1,2,2-tris(methylsilyloxy)ethenyl]silane?
tris[1,2,2-tris(methylsilyloxy)ethenyl]silane has a molecular weight of 651.38 g/mol, XLogP of -3.33, 21 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tris[1,2,2-tris(methylsilyloxy)ethenyl]silane is sourced from PubChem (CID 123509496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).