C14H17BrF3N3OS — CID 123509621
(2S)-2-[[1-(5-bromothiophen-2-yl)-2,2,2-trifluoroethyl]-(cyanomethyl)amino]-4-methylpentanamide (PubChem CID 123509621) has the molecular formula C14H17BrF3N3OS and a molecular weight of 412.28 g/mol. Its IUPAC name is (2S)-2-[[1-(5-bromothiophen-2-yl)-2,2,2-trifluoroethyl]-(cyanomethyl)amino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[1-(5-bromothiophen-2-yl)-2,2,2-trifluoroethyl]-(cyanomethyl)amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 123509621 |
| Molecular Formula | C14H17BrF3N3OS |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | (2S)-2-[[1-(5-bromothiophen-2-yl)-2,2,2-trifluoroethyl]-(cyanomethyl)amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](C(N)=O)N(CC#N)C(c1ccc(Br)s1)C(F)(F)F |
| InChI | InChI=1S/C14H17BrF3N3OS/c1-8(2)7-9(13(20)22)21(6-5-19)12(14(16,17)18)10-3-4-11(15)23-10/h3-4,8-9,12H,6-7H2,1-2H3,(H2,20,22)/t9-,12?/m0/s1 |
| InChIKey | DWKCBTCTYIFQMT-QHGLUPRGSA-N |
| XLogP | 3.84 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|