C23H29FN2O3Si — CID 123509914
methyl 4-[[(3,3-dimethyl-1,3-azasilolidine-5-carbonyl)-[1-(2-fluorophenyl)ethyl]amino]methyl]benzoate (PubChem CID 123509914) has the molecular formula C23H29FN2O3Si and a molecular weight of 428.58 g/mol. Its IUPAC name is methyl 4-[[(3,3-dimethyl-1,3-azasilolidine-5-carbonyl)-[1-(2-fluorophenyl)ethyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[(3,3-dimethyl-1,3-azasilolidine-5-carbonyl)-[1-(2-fluorophenyl)ethyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 123509914 |
| Molecular Formula | C23H29FN2O3Si |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | methyl 4-[[(3,3-dimethyl-1,3-azasilolidine-5-carbonyl)-[1-(2-fluorophenyl)ethyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)C2C[Si](C)(C)CN2)C(C)c2ccccc2F)cc1 |
| InChI | InChI=1S/C23H29FN2O3Si/c1-16(19-7-5-6-8-20(19)24)26(22(27)21-14-30(3,4)15-25-21)13-17-9-11-18(12-10-17)23(28)29-2/h5-12,16,21,25H,13-15H2,1-4H3 |
| InChIKey | VWSUELDOBLDKKT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|