C21H19N3S2 — CID 123510156
N-(3-methylphenyl)-4-[5-(2-thiophen-2-ylethyl)thiophen-2-yl]pyrimidin-2-amine (PubChem CID 123510156) has the molecular formula C21H19N3S2 and a molecular weight of 377.54 g/mol. Its IUPAC name is N-(3-methylphenyl)-4-[5-(2-thiophen-2-ylethyl)thiophen-2-yl]pyrimidin-2-amine.
| Compound Name | N-(3-methylphenyl)-4-[5-(2-thiophen-2-ylethyl)thiophen-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 123510156 |
| Molecular Formula | C21H19N3S2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-(3-methylphenyl)-4-[5-(2-thiophen-2-ylethyl)thiophen-2-yl]pyrimidin-2-amine |
| SMILES | Cc1cccc(Nc2nccc(-c3ccc(CCc4cccs4)s3)n2)c1 |
| InChI | InChI=1S/C21H19N3S2/c1-15-4-2-5-16(14-15)23-21-22-12-11-19(24-21)20-10-9-18(26-20)8-7-17-6-3-13-25-17/h2-6,9-14H,7-8H2,1H3,(H,22,23,24) |
| InChIKey | UXEAVBPNJWDOOO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |