About spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide
spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide (PubChem CID 123510278) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide.
Molecular Properties
| Compound Name | spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide |
| PubChem CID | 123510278 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)C1(CCN2)CC1 |
| InChI | InChI=1S/C12H14N2O/c13-11(15)8-1-2-10-9(7-8)12(3-4-12)5-6-14-10/h1-2,7,14H,3-6H2,(H2,13,15) |
| InChIKey | VAGVODGJIYEYPE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide?
The IUPAC name of spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide (CID 123510278) is spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide.
What is the SMILES notation for spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide?
The canonical SMILES for spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide is NC(=O)c1ccc2c(c1)C1(CCN2)CC1.
What is the InChIKey of spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide?
The InChIKey is VAGVODGJIYEYPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c13-11(15)8-1-2-10-9(7-8)12(3-4-12)5-6-14-10/h1-2,7,14H,3-6H2,(H2,13,15).
What are the key properties of spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide?
spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide has a molecular weight of 202.26 g/mol, XLogP of 1.63, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2,3-dihydro-1H-quinoline-4,1'-cyclopropane]-6-carboxamide is sourced from PubChem (CID 123510278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).