About 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide
3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide (PubChem CID 123510341) has the molecular formula C15H23NO6
and a molecular weight of 313.35 g/mol. Its IUPAC name is 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide.
Molecular Properties
| Compound Name | 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide |
| PubChem CID | 123510341 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide |
| SMILES | O=C(CC(CO)Cc1ccc(O)cc1O)NCCOCCO |
| InChI | InChI=1S/C15H23NO6/c17-4-6-22-5-3-16-15(21)8-11(10-18)7-12-1-2-13(19)9-14(12)20/h1-2,9,11,17-20H,3-8,10H2,(H,16,21) |
| InChIKey | MPXKFEDFUKHAAK-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide?
The IUPAC name of 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide (CID 123510341) is 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide.
What is the SMILES notation for 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide?
The canonical SMILES for 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide is O=C(CC(CO)Cc1ccc(O)cc1O)NCCOCCO.
What is the InChIKey of 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide?
The InChIKey is MPXKFEDFUKHAAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO6/c17-4-6-22-5-3-16-15(21)8-11(10-18)7-12-1-2-13(19)9-14(12)20/h1-2,9,11,17-20H,3-8,10H2,(H,16,21).
What are the key properties of 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide?
3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide has a molecular weight of 313.35 g/mol, XLogP of -0.24, 10 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dihydroxyphenyl)methyl]-4-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]butanamide is sourced from PubChem (CID 123510341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).