2,3-dimethylidenepentanedioic acid

C7H8O4 — CID 123510533

IUPAC2,3-dimethylidenepentanedioic acid
SMILESC=C(CC(=O)O)C(=C)C(=O)O
InChIInChI=1S/C7H8O4/c1-4(3-6(8)9)5(2)7(10)11/h1-3H2,(H,8,9)(H,10,11)
InChIKeyYNNMOGWGBFSMGB-UHFFFAOYSA-N
MW156.14 g/mol
LogP0.66
Rot. Bonds4

About 2,3-dimethylidenepentanedioic acid

2,3-dimethylidenepentanedioic acid (PubChem CID 123510533) has the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. Its IUPAC name is 2,3-dimethylidenepentanedioic acid.

Molecular Properties

Compound Name2,3-dimethylidenepentanedioic acid
PubChem CID123510533
Molecular FormulaC7H8O4
Molecular Weight156.14 g/mol
Exact Mass156.04
IUPAC Name2,3-dimethylidenepentanedioic acid
SMILESC=C(CC(=O)O)C(=C)C(=O)O
InChIInChI=1S/C7H8O4/c1-4(3-6(8)9)5(2)7(10)11/h1-3H2,(H,8,9)(H,10,11)
InChIKeyYNNMOGWGBFSMGB-UHFFFAOYSA-N
XLogP0.66
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.14
LogP ≤ 50.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2,3-dimethylidenepentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethylidenepentanedioic acid?
The IUPAC name of 2,3-dimethylidenepentanedioic acid (CID 123510533) is 2,3-dimethylidenepentanedioic acid.
What is the SMILES notation for 2,3-dimethylidenepentanedioic acid?
The canonical SMILES for 2,3-dimethylidenepentanedioic acid is C=C(CC(=O)O)C(=C)C(=O)O.
What is the InChIKey of 2,3-dimethylidenepentanedioic acid?
The InChIKey is YNNMOGWGBFSMGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c1-4(3-6(8)9)5(2)7(10)11/h1-3H2,(H,8,9)(H,10,11).
What are the key properties of 2,3-dimethylidenepentanedioic acid?
2,3-dimethylidenepentanedioic acid has a molecular weight of 156.14 g/mol, XLogP of 0.66, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylidenepentanedioic acid is sourced from PubChem (CID 123510533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).