C18H16ClFN2O3 — CID 123510794
ethyl 2-[6-(3-chloro-4-fluorophenyl)-5-methoxy-2-pyridinyl]-2-isocyanopropanoate (PubChem CID 123510794) has the molecular formula C18H16ClFN2O3 and a molecular weight of 362.79 g/mol. Its IUPAC name is ethyl 2-[6-(3-chloro-4-fluorophenyl)-5-methoxy-2-pyridinyl]-2-isocyanopropanoate.
| Compound Name | ethyl 2-[6-(3-chloro-4-fluorophenyl)-5-methoxy-2-pyridinyl]-2-isocyanopropanoate |
|---|---|
| PubChem CID | 123510794 |
| Molecular Formula | C18H16ClFN2O3 |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | ethyl 2-[6-(3-chloro-4-fluorophenyl)-5-methoxy-2-pyridinyl]-2-isocyanopropanoate |
| SMILES | [C-]#[N+]C(C)(C(=O)OCC)c1ccc(OC)c(-c2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C18H16ClFN2O3/c1-5-25-17(23)18(2,21-3)15-9-8-14(24-4)16(22-15)11-6-7-13(20)12(19)10-11/h6-10H,5H2,1-2,4H3 |
| InChIKey | ZQDVAEFQKWZTLZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|