About N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide
N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide (PubChem CID 123511038) has the molecular formula C11H14F2N2
and a molecular weight of 212.24 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide.
Molecular Properties
| Compound Name | N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide |
| PubChem CID | 123511038 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide |
| SMILES | CC/C(=N\C)NCc1c(F)cccc1F |
| InChI | InChI=1S/C11H14F2N2/c1-3-11(14-2)15-7-8-9(12)5-4-6-10(8)13/h4-6H,3,7H2,1-2H3,(H,14,15) |
| InChIKey | GJNPGJOXPQFPBG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide?
The IUPAC name of N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide (CID 123511038) is N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide.
What is the SMILES notation for N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide?
The canonical SMILES for N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide is CC/C(=N\C)NCc1c(F)cccc1F.
What is the InChIKey of N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide?
The InChIKey is GJNPGJOXPQFPBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2N2/c1-3-11(14-2)15-7-8-9(12)5-4-6-10(8)13/h4-6H,3,7H2,1-2H3,(H,14,15).
What are the key properties of N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide?
N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide has a molecular weight of 212.24 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,6-difluorophenyl)methyl]-N'-methylpropanimidamide is sourced from PubChem (CID 123511038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).