About 1-buta-2,3-dienyl-2-ethylcyclopropane
1-buta-2,3-dienyl-2-ethylcyclopropane (PubChem CID 123511287) has the molecular formula C9H14
and a molecular weight of 122.21 g/mol. Its IUPAC name is 1-buta-2,3-dienyl-2-ethylcyclopropane.
Molecular Properties
| Compound Name | 1-buta-2,3-dienyl-2-ethylcyclopropane |
| PubChem CID | 123511287 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | 1-buta-2,3-dienyl-2-ethylcyclopropane |
| SMILES | C=C=CCC1CC1CC |
| InChI | InChI=1S/C9H14/c1-3-5-6-9-7-8(9)4-2/h5,8-9H,1,4,6-7H2,2H3 |
| InChIKey | APZOIBXPWWRUIA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-buta-2,3-dienyl-2-ethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-2,3-dienyl-2-ethylcyclopropane?
The IUPAC name of 1-buta-2,3-dienyl-2-ethylcyclopropane (CID 123511287) is 1-buta-2,3-dienyl-2-ethylcyclopropane.
What is the SMILES notation for 1-buta-2,3-dienyl-2-ethylcyclopropane?
The canonical SMILES for 1-buta-2,3-dienyl-2-ethylcyclopropane is C=C=CCC1CC1CC.
What is the InChIKey of 1-buta-2,3-dienyl-2-ethylcyclopropane?
The InChIKey is APZOIBXPWWRUIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14/c1-3-5-6-9-7-8(9)4-2/h5,8-9H,1,4,6-7H2,2H3.
What are the key properties of 1-buta-2,3-dienyl-2-ethylcyclopropane?
1-buta-2,3-dienyl-2-ethylcyclopropane has a molecular weight of 122.21 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-2,3-dienyl-2-ethylcyclopropane is sourced from PubChem (CID 123511287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).