C10H13F5O3 — CID 123511406
1,1,1,3,3-pentafluoro-2,2-dihydroxydec-5-en-4-one (PubChem CID 123511406) has the molecular formula C10H13F5O3 and a molecular weight of 276.20 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-2,2-dihydroxydec-5-en-4-one.
| Compound Name | 1,1,1,3,3-pentafluoro-2,2-dihydroxydec-5-en-4-one |
|---|---|
| PubChem CID | 123511406 |
| Molecular Formula | C10H13F5O3 |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-2,2-dihydroxydec-5-en-4-one |
| SMILES | CCCCC=CC(=O)C(F)(F)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H13F5O3/c1-2-3-4-5-6-7(16)8(11,12)9(17,18)10(13,14)15/h5-6,17-18H,2-4H2,1H3 |
| InChIKey | CRKRCXUHDSVINS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|