C47H43FN6O2 — CID 123511492
N-[(3R)-3-[2-(dimethylamino)-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-yl]-3-pyridin-4-yl-N-trityl-1H-indazole-5-carboxamide (PubChem CID 123511492) has the molecular formula C47H43FN6O2 and a molecular weight of 742.90 g/mol. Its IUPAC name is N-[(3R)-3-[2-(dimethylamino)-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-yl]-3-pyridin-4-yl-N-trityl-1H-indazole-5-carboxamide.
| Compound Name | N-[(3R)-3-[2-(dimethylamino)-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-yl]-3-pyridin-4-yl-N-trityl-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 123511492 |
| Molecular Formula | C47H43FN6O2 |
| Molecular Weight | 742.90 g/mol |
| Exact Mass | 742.34 |
| IUPAC Name | N-[(3R)-3-[2-(dimethylamino)-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-yl]-3-pyridin-4-yl-N-trityl-1H-indazole-5-carboxamide |
| SMILES | CN(C)C(=O)C(c1ccccc1F)[C@]1(N(C(=O)c2ccc3[nH]nc(-c4ccncc4)c3c2)C(c2ccccc2)(c2ccccc2)c2ccccc2)CCCNC1 |
| InChI | InChI=1S/C47H43FN6O2/c1-53(2)45(56)42(38-21-12-13-22-40(38)48)46(27-14-28-50-32-46)54(44(55)34-23-24-41-39(31-34)43(52-51-41)33-25-29-49-30-26-33)47(35-15-6-3-7-16-35,36-17-8-4-9-18-36)37-19-10-5-11-20-37/h3-13,15-26,29-31,42,50H,14,27-28,32H2,1-2H3,(H,51,52)/t42?,46-/m0/s1 |
| InChIKey | LOHLGEJHTGRNNV-FLDCQSRISA-N |
| XLogP | 8.19 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.90 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|