C21H23NO4 — CID 123511555
5,6,8,9-tetramethoxy-N-methyl-12H-benzo[a]heptalen-7-imine (PubChem CID 123511555) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 5,6,8,9-tetramethoxy-N-methyl-12H-benzo[a]heptalen-7-imine.
| Compound Name | 5,6,8,9-tetramethoxy-N-methyl-12H-benzo[a]heptalen-7-imine |
|---|---|
| PubChem CID | 123511555 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 5,6,8,9-tetramethoxy-N-methyl-12H-benzo[a]heptalen-7-imine |
| SMILES | C/N=c1\c(OC)c(OC)c2ccccc2c2c1C(OC)=C(OC)C=CC2 |
| InChI | InChI=1S/C21H23NO4/c1-22-18-17-14(11-8-12-16(23-2)20(17)25-4)13-9-6-7-10-15(13)19(24-3)21(18)26-5/h6-10,12H,11H2,1-5H3/b22-18- |
| InChIKey | SBDYWQANRAHELP-PYCFMQQDSA-N |
| XLogP | 3.46 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |