About tricyclo[4.3.1.02,9]decan-8-one
tricyclo[4.3.1.02,9]decan-8-one (PubChem CID 123511592) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is tricyclo[4.3.1.02,9]decan-8-one.
Molecular Properties
| Compound Name | tricyclo[4.3.1.02,9]decan-8-one |
| PubChem CID | 123511592 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | tricyclo[4.3.1.02,9]decan-8-one |
| SMILES | O=C1CC2CCCC3C(C2)C13 |
| InChI | InChI=1S/C10H14O/c11-9-5-6-2-1-3-7-8(4-6)10(7)9/h6-8,10H,1-5H2 |
| InChIKey | VSHJHPFXUGBRQW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tricyclo[4.3.1.02,9]decan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[4.3.1.02,9]decan-8-one?
The IUPAC name of tricyclo[4.3.1.02,9]decan-8-one (CID 123511592) is tricyclo[4.3.1.02,9]decan-8-one.
What is the SMILES notation for tricyclo[4.3.1.02,9]decan-8-one?
The canonical SMILES for tricyclo[4.3.1.02,9]decan-8-one is O=C1CC2CCCC3C(C2)C13.
What is the InChIKey of tricyclo[4.3.1.02,9]decan-8-one?
The InChIKey is VSHJHPFXUGBRQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c11-9-5-6-2-1-3-7-8(4-6)10(7)9/h6-8,10H,1-5H2.
What are the key properties of tricyclo[4.3.1.02,9]decan-8-one?
tricyclo[4.3.1.02,9]decan-8-one has a molecular weight of 150.22 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[4.3.1.02,9]decan-8-one is sourced from PubChem (CID 123511592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).