C10H14O — CID 123511592
tricyclo[4.3.1.02,9]decan-8-one (PubChem CID 123511592) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is tricyclo[4.3.1.02,9]decan-8-one.
| Compound Name | tricyclo[4.3.1.02,9]decan-8-one |
|---|---|
| PubChem CID | 123511592 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | tricyclo[4.3.1.02,9]decan-8-one |
| SMILES | O=C1CC2CCCC3C(C2)C13 |
| InChI | InChI=1S/C10H14O/c11-9-5-6-2-1-3-7-8(4-6)10(7)9/h6-8,10H,1-5H2 |
| InChIKey | VSHJHPFXUGBRQW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |