C19H32N2 — CID 123511632
1-(6-ethyl-8-methyl-4-methylideneundeca-2,6,10-trien-3-yl)piperazine (PubChem CID 123511632) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 1-(6-ethyl-8-methyl-4-methylideneundeca-2,6,10-trien-3-yl)piperazine.
| Compound Name | 1-(6-ethyl-8-methyl-4-methylideneundeca-2,6,10-trien-3-yl)piperazine |
|---|---|
| PubChem CID | 123511632 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 1-(6-ethyl-8-methyl-4-methylideneundeca-2,6,10-trien-3-yl)piperazine |
| SMILES | C=CCC(C)C=C(CC)CC(=C)C(=CC)N1CCNCC1 |
| InChI | InChI=1S/C19H32N2/c1-6-9-16(4)14-18(7-2)15-17(5)19(8-3)21-12-10-20-11-13-21/h6,8,14,16,20H,1,5,7,9-13,15H2,2-4H3 |
| InChIKey | UBBVTVUNWGZOCS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|