C14H23N4O5SSi+ — CID 123512557
trimethylsilyl 3-methyl-3-[(3-methyltriazol-3-ium-1-yl)methyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 123512557) has the molecular formula C14H23N4O5SSi+ and a molecular weight of 387.51 g/mol. Its IUPAC name is trimethylsilyl 3-methyl-3-[(3-methyltriazol-3-ium-1-yl)methyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | trimethylsilyl 3-methyl-3-[(3-methyltriazol-3-ium-1-yl)methyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 123512557 |
| Molecular Formula | C14H23N4O5SSi+ |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | trimethylsilyl 3-methyl-3-[(3-methyltriazol-3-ium-1-yl)methyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[n+]1ccn(CC2(C)C(C(=O)O[Si](C)(C)C)N3C(=O)CC3S2(=O)=O)n1 |
| InChI | InChI=1S/C14H23N4O5SSi/c1-14(9-17-7-6-16(2)15-17)12(13(20)23-25(3,4)5)18-10(19)8-11(18)24(14,21)22/h6-7,11-12H,8-9H2,1-5H3/q+1 |
| InChIKey | FUSSRIMMAUYQJK-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|