C9H16N2 — CID 123512702
2,4-diethyl-5-methyl-1,4-dihydropyrimidine (PubChem CID 123512702) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2,4-diethyl-5-methyl-1,4-dihydropyrimidine.
| Compound Name | 2,4-diethyl-5-methyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 123512702 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2,4-diethyl-5-methyl-1,4-dihydropyrimidine |
| SMILES | CCC1=NC(CC)C(C)=CN1 |
| InChI | InChI=1S/C9H16N2/c1-4-8-7(3)6-10-9(5-2)11-8/h6,8H,4-5H2,1-3H3,(H,10,11) |
| InChIKey | LCMICCPVQBOATG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |