About butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate
butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate (PubChem CID 123512748) has the molecular formula C9H15F3O3S
and a molecular weight of 260.28 g/mol. Its IUPAC name is butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate.
Molecular Properties
| Compound Name | butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate |
| PubChem CID | 123512748 |
| Molecular Formula | C9H15F3O3S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate |
| SMILES | CCCCOC(=O)CS(=O)CCC(F)(F)F |
| InChI | InChI=1S/C9H15F3O3S/c1-2-3-5-15-8(13)7-16(14)6-4-9(10,11)12/h2-7H2,1H3 |
| InChIKey | ZECVMNNWLVJVKB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate?
The IUPAC name of butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate (CID 123512748) is butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate.
What is the SMILES notation for butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate?
The canonical SMILES for butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate is CCCCOC(=O)CS(=O)CCC(F)(F)F.
What is the InChIKey of butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate?
The InChIKey is ZECVMNNWLVJVKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3O3S/c1-2-3-5-15-8(13)7-16(14)6-4-9(10,11)12/h2-7H2,1H3.
What are the key properties of butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate?
butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate has a molecular weight of 260.28 g/mol, XLogP of 2.03, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-(3,3,3-trifluoropropylsulfinyl)acetate is sourced from PubChem (CID 123512748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).