C16H26N2O2 — CID 123512908
5-[3-(4-methoxyhexa-1,3,5-trien-3-yloxy)propyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole (PubChem CID 123512908) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 5-[3-(4-methoxyhexa-1,3,5-trien-3-yloxy)propyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole.
| Compound Name | 5-[3-(4-methoxyhexa-1,3,5-trien-3-yloxy)propyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 123512908 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 5-[3-(4-methoxyhexa-1,3,5-trien-3-yloxy)propyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole |
| SMILES | C=CC(OC)=C(C=C)OCCCN1CC2CCNC2C1 |
| InChI | InChI=1S/C16H26N2O2/c1-4-15(19-3)16(5-2)20-10-6-9-18-11-13-7-8-17-14(13)12-18/h4-5,13-14,17H,1-2,6-12H2,3H3 |
| InChIKey | HDLOSKWKFLAECM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|