C20H22ClN5O3 — CID 123512932
ethyl 2-[2-[(4-butan-2-ylbenzoyl)amino]-6-chloropurin-9-yl]acetate (PubChem CID 123512932) has the molecular formula C20H22ClN5O3 and a molecular weight of 415.88 g/mol. Its IUPAC name is ethyl 2-[2-[(4-butan-2-ylbenzoyl)amino]-6-chloropurin-9-yl]acetate.
| Compound Name | ethyl 2-[2-[(4-butan-2-ylbenzoyl)amino]-6-chloropurin-9-yl]acetate |
|---|---|
| PubChem CID | 123512932 |
| Molecular Formula | C20H22ClN5O3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | ethyl 2-[2-[(4-butan-2-ylbenzoyl)amino]-6-chloropurin-9-yl]acetate |
| SMILES | CCOC(=O)Cn1cnc2c(Cl)nc(NC(=O)c3ccc(C(C)CC)cc3)nc21 |
| InChI | InChI=1S/C20H22ClN5O3/c1-4-12(3)13-6-8-14(9-7-13)19(28)25-20-23-17(21)16-18(24-20)26(11-22-16)10-15(27)29-5-2/h6-9,11-12H,4-5,10H2,1-3H3,(H,23,24,25,28) |
| InChIKey | XKSGVCWXDIMIKM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |