About N'-(3-methylpent-1-enyl)ethane-1,2-diimine
N'-(3-methylpent-1-enyl)ethane-1,2-diimine (PubChem CID 123513166) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is N'-(3-methylpent-1-enyl)ethane-1,2-diimine.
Molecular Properties
| Compound Name | N'-(3-methylpent-1-enyl)ethane-1,2-diimine |
| PubChem CID | 123513166 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N'-(3-methylpent-1-enyl)ethane-1,2-diimine |
| SMILES | [H]/N=C/C=N/C=CC(C)CC |
| InChI | InChI=1S/C8H14N2/c1-3-8(2)4-6-10-7-5-9/h4-9H,3H2,1-2H3/b6-4?,9-5+,10-7+ |
| InChIKey | HQXKNAABVOUMGC-NDVHFPPXSA-N |
| XLogP | 2.27 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-methylpent-1-enyl)ethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-methylpent-1-enyl)ethane-1,2-diimine?
The IUPAC name of N'-(3-methylpent-1-enyl)ethane-1,2-diimine (CID 123513166) is N'-(3-methylpent-1-enyl)ethane-1,2-diimine.
What is the SMILES notation for N'-(3-methylpent-1-enyl)ethane-1,2-diimine?
The canonical SMILES for N'-(3-methylpent-1-enyl)ethane-1,2-diimine is [H]/N=C/C=N/C=CC(C)CC.
What is the InChIKey of N'-(3-methylpent-1-enyl)ethane-1,2-diimine?
The InChIKey is HQXKNAABVOUMGC-NDVHFPPXSA-N. The full InChI is InChI=1S/C8H14N2/c1-3-8(2)4-6-10-7-5-9/h4-9H,3H2,1-2H3/b6-4?,9-5+,10-7+.
What are the key properties of N'-(3-methylpent-1-enyl)ethane-1,2-diimine?
N'-(3-methylpent-1-enyl)ethane-1,2-diimine has a molecular weight of 138.21 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-methylpent-1-enyl)ethane-1,2-diimine is sourced from PubChem (CID 123513166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).