C30H49N4O3+ — CID 123513192
3-heptan-4-yl-1-methyl-N-[3-methyl-2-(methylaminomethyl)-6-oxo-5-propan-2-yl-3,4-dihydro-2H-1,5-benzoxazocin-10-yl]-2,3,4,5-tetrahydropyridin-1-ium-4-carboxamide (PubChem CID 123513192) has the molecular formula C30H49N4O3+ and a molecular weight of 513.75 g/mol. Its IUPAC name is 3-heptan-4-yl-1-methyl-N-[3-methyl-2-(methylaminomethyl)-6-oxo-5-propan-2-yl-3,4-dihydro-2H-1,5-benzoxazocin-10-yl]-2,3,4,5-tetrahydropyridin-1-ium-4-carboxamide.
| Compound Name | 3-heptan-4-yl-1-methyl-N-[3-methyl-2-(methylaminomethyl)-6-oxo-5-propan-2-yl-3,4-dihydro-2H-1,5-benzoxazocin-10-yl]-2,3,4,5-tetrahydropyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 123513192 |
| Molecular Formula | C30H49N4O3+ |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.38 |
| IUPAC Name | 3-heptan-4-yl-1-methyl-N-[3-methyl-2-(methylaminomethyl)-6-oxo-5-propan-2-yl-3,4-dihydro-2H-1,5-benzoxazocin-10-yl]-2,3,4,5-tetrahydropyridin-1-ium-4-carboxamide |
| SMILES | CCCC(CCC)C1C[N+](C)=CCC1C(=O)Nc1cccc2c1OC(CNC)C(C)CN(C(C)C)C2=O |
| InChI | InChI=1S/C30H48N4O3/c1-8-11-22(12-9-2)25-19-33(7)16-15-23(25)29(35)32-26-14-10-13-24-28(26)37-27(17-31-6)21(5)18-34(20(3)4)30(24)36/h10,13-14,16,20-23,25,27,31H,8-9,11-12,15,17-19H2,1-7H3/p+1 |
| InChIKey | IPIGDDFURUDXDU-UHFFFAOYSA-O |
| XLogP | 4.66 |
| TPSA | 73.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|