C50H46F3N9 — CID 123513208
4,6-bis[(3-methylphenyl)methyl]-N-pyridin-3-yl-1,3,5-triazin-2-amine;4,6-bis[(3-methylphenyl)methyl]-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 123513208) has the molecular formula C50H46F3N9 and a molecular weight of 829.98 g/mol. Its IUPAC name is 4,6-bis[(3-methylphenyl)methyl]-N-pyridin-3-yl-1,3,5-triazin-2-amine;4,6-bis[(3-methylphenyl)methyl]-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[(3-methylphenyl)methyl]-N-pyridin-3-yl-1,3,5-triazin-2-amine;4,6-bis[(3-methylphenyl)methyl]-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123513208 |
| Molecular Formula | C50H46F3N9 |
| Molecular Weight | 829.98 g/mol |
| Exact Mass | 829.38 |
| IUPAC Name | 4,6-bis[(3-methylphenyl)methyl]-N-pyridin-3-yl-1,3,5-triazin-2-amine;4,6-bis[(3-methylphenyl)methyl]-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | Cc1cccc(Cc2nc(Cc3cccc(C)c3)nc(Nc3ccc(C(F)(F)F)cc3)n2)c1.Cc1cccc(Cc2nc(Cc3cccc(C)c3)nc(Nc3cccnc3)n2)c1 |
| InChI | InChI=1S/C26H23F3N4.C24H23N5/c1-17-5-3-7-19(13-17)15-23-31-24(16-20-8-4-6-18(2)14-20)33-25(32-23)30-22-11-9-21(10-12-22)26(27,28)29;1-17-6-3-8-19(12-17)14-22-27-23(15-20-9-4-7-18(2)13-20)29-24(28-22)26-21-10-5-11-25-16-21/h3-14H,15-16H2,1-2H3,(H,30,31,32,33);3-13,16H,14-15H2,1-2H3,(H,26,27,28,29) |
| InChIKey | CDKOIQBFFMIWIT-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.98 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |