About N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine
N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine (PubChem CID 123513819) has the molecular formula C10H12F3N
and a molecular weight of 203.21 g/mol. Its IUPAC name is N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine.
Molecular Properties
| Compound Name | N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine |
| PubChem CID | 123513819 |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine |
| SMILES | C/N=C1\C=C(C(F)(F)F)CCC=C1C |
| InChI | InChI=1S/C10H12F3N/c1-7-4-3-5-8(10(11,12)13)6-9(7)14-2/h4,6H,3,5H2,1-2H3/b14-9+ |
| InChIKey | FAKOLVVHIBMJJL-NTEUORMPSA-N |
| XLogP | 3.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine?
The IUPAC name of N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine (CID 123513819) is N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine.
What is the SMILES notation for N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine?
The canonical SMILES for N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine is C/N=C1\C=C(C(F)(F)F)CCC=C1C.
What is the InChIKey of N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine?
The InChIKey is FAKOLVVHIBMJJL-NTEUORMPSA-N. The full InChI is InChI=1S/C10H12F3N/c1-7-4-3-5-8(10(11,12)13)6-9(7)14-2/h4,6H,3,5H2,1-2H3/b14-9+.
What are the key properties of N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine?
N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine has a molecular weight of 203.21 g/mol, XLogP of 3.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-6-(trifluoromethyl)cyclohepta-2,6-dien-1-imine is sourced from PubChem (CID 123513819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).