C30H51N7O10S — CID 123513831
2-[4-[5-[3-[2-(5-aminopentylamino)-2-oxoethyl]sulfanyl-2,5-dihydroxypyrrol-1-yl]-2-oxopentyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 123513831) has the molecular formula C30H51N7O10S and a molecular weight of 701.84 g/mol. Its IUPAC name is 2-[4-[5-[3-[2-(5-aminopentylamino)-2-oxoethyl]sulfanyl-2,5-dihydroxypyrrol-1-yl]-2-oxopentyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[5-[3-[2-(5-aminopentylamino)-2-oxoethyl]sulfanyl-2,5-dihydroxypyrrol-1-yl]-2-oxopentyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 123513831 |
| Molecular Formula | C30H51N7O10S |
| Molecular Weight | 701.84 g/mol |
| Exact Mass | 701.34 |
| IUPAC Name | 2-[4-[5-[3-[2-(5-aminopentylamino)-2-oxoethyl]sulfanyl-2,5-dihydroxypyrrol-1-yl]-2-oxopentyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | NCCCCCNC(=O)CSc1cc(O)n(CCCC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c1O |
| InChI | InChI=1S/C30H51N7O10S/c31-6-2-1-3-7-32-25(39)22-48-24-17-26(40)37(30(24)47)8-4-5-23(38)18-33-9-11-34(19-27(41)42)13-15-36(21-29(45)46)16-14-35(12-10-33)20-28(43)44/h17,40,47H,1-16,18-22,31H2,(H,32,39)(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | IUYDMTHIGQUCAW-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 242.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.84 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|