C23H26F2O10S — CID 123514066
bis(ethoxycarbonyloxymethyl) 3-[(3,4-difluorophenyl)sulfanylmethyl]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 123514066) has the molecular formula C23H26F2O10S and a molecular weight of 532.51 g/mol. Its IUPAC name is bis(ethoxycarbonyloxymethyl) 3-[(3,4-difluorophenyl)sulfanylmethyl]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | bis(ethoxycarbonyloxymethyl) 3-[(3,4-difluorophenyl)sulfanylmethyl]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 123514066 |
| Molecular Formula | C23H26F2O10S |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | bis(ethoxycarbonyloxymethyl) 3-[(3,4-difluorophenyl)sulfanylmethyl]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)OCOC(=O)C1C(CSc2ccc(F)c(F)c2)CC2C(C(=O)OCOC(=O)OCC)C21 |
| InChI | InChI=1S/C23H26F2O10S/c1-3-30-22(28)34-10-32-20(26)17-12(9-36-13-5-6-15(24)16(25)8-13)7-14-18(17)19(14)21(27)33-11-35-23(29)31-4-2/h5-6,8,12,14,17-19H,3-4,7,9-11H2,1-2H3 |
| InChIKey | JQRAYTOEMPDZPY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|