About N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine
N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine (PubChem CID 123514156) has the molecular formula C10H17FN2
and a molecular weight of 184.26 g/mol. Its IUPAC name is N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine |
| PubChem CID | 123514156 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine |
| SMILES | CC(CN)CNC1C=C(F)C=CC1 |
| InChI | InChI=1S/C10H17FN2/c1-8(6-12)7-13-10-4-2-3-9(11)5-10/h2-3,5,8,10,13H,4,6-7,12H2,1H3 |
| InChIKey | VQEOIRXPRBDOLS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine?
The IUPAC name of N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine (CID 123514156) is N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine.
What is the SMILES notation for N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine?
The canonical SMILES for N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine is CC(CN)CNC1C=C(F)C=CC1.
What is the InChIKey of N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine?
The InChIKey is VQEOIRXPRBDOLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17FN2/c1-8(6-12)7-13-10-4-2-3-9(11)5-10/h2-3,5,8,10,13H,4,6-7,12H2,1H3.
What are the key properties of N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine?
N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine has a molecular weight of 184.26 g/mol, XLogP of 1.35, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-fluorocyclohexa-2,4-dien-1-yl)-2-methylpropane-1,3-diamine is sourced from PubChem (CID 123514156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).