C24H26NO2S+ — CID 123514481
19,19-diethyl-15,15-dimethyl-3,5-dioxa-13-thia-18-azoniahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),7,9,11,16,18(22)-heptaene (PubChem CID 123514481) has the molecular formula C24H26NO2S+ and a molecular weight of 392.54 g/mol. Its IUPAC name is 19,19-diethyl-15,15-dimethyl-3,5-dioxa-13-thia-18-azoniahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),7,9,11,16,18(22)-heptaene.
| Compound Name | 19,19-diethyl-15,15-dimethyl-3,5-dioxa-13-thia-18-azoniahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),7,9,11,16,18(22)-heptaene |
|---|---|
| PubChem CID | 123514481 |
| Molecular Formula | C24H26NO2S+ |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 19,19-diethyl-15,15-dimethyl-3,5-dioxa-13-thia-18-azoniahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),7,9,11,16,18(22)-heptaene |
| SMILES | CCC1(CC)Cc2c3c(cc4ccc5c6c(c[n+]1c5c24)C(C)(C)CS6)OCO3 |
| InChI | InChI=1S/C24H26NO2S/c1-5-24(6-2)10-16-19-14(9-18-21(16)27-13-26-18)7-8-15-20(19)25(24)11-17-22(15)28-12-23(17,3)4/h7-9,11H,5-6,10,12-13H2,1-4H3/q+1 |
| InChIKey | JEFRKEFWRXISNQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|