C8H11NO — CID 123514732
5,6,7,8-tetrahydro-3H-pyrano[4,3-c]pyridine (PubChem CID 123514732) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-3H-pyrano[4,3-c]pyridine.
| Compound Name | 5,6,7,8-tetrahydro-3H-pyrano[4,3-c]pyridine |
|---|---|
| PubChem CID | 123514732 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 5,6,7,8-tetrahydro-3H-pyrano[4,3-c]pyridine |
| SMILES | C1=C2CCNCC2=CCO1 |
| InChI | InChI=1S/C8H11NO/c1-3-9-5-7-2-4-10-6-8(1)7/h2,6,9H,1,3-5H2 |
| InChIKey | YYSXFXHLCLYAIL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |