About (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid (PubChem CID 123515064) has the molecular formula C13H19BO4
and a molecular weight of 250.10 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid.
Molecular Properties
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid |
| PubChem CID | 123515064 |
| Molecular Formula | C13H19BO4 |
| Molecular Weight | 250.10 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)C1=CC=CCC1=C=O |
| InChI | InChI=1S/C13H19BO4/c1-12(2,16)13(3,4)18-14(17)11-8-6-5-7-10(11)9-15/h5-6,8,16-17H,7H2,1-4H3 |
| InChIKey | CJZZSJUMDCBQBL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.10 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid?
The IUPAC name of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid (CID 123515064) is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid.
What is the SMILES notation for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid?
The canonical SMILES for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid is CC(C)(O)C(C)(C)OB(O)C1=CC=CCC1=C=O.
What is the InChIKey of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid?
The InChIKey is CJZZSJUMDCBQBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BO4/c1-12(2,16)13(3,4)18-14(17)11-8-6-5-7-10(11)9-15/h5-6,8,16-17H,7H2,1-4H3.
What are the key properties of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid?
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid has a molecular weight of 250.10 g/mol, XLogP of 1.22, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[6-(oxomethylidene)cyclohexa-1,3-dien-1-yl]borinic acid is sourced from PubChem (CID 123515064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).