C14H11ClN4O2 — CID 123515071
N-(3-chlorophenyl)-N'-pyrimidin-4-ylbut-2-enediamide (PubChem CID 123515071) has the molecular formula C14H11ClN4O2 and a molecular weight of 302.72 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N'-pyrimidin-4-ylbut-2-enediamide.
| Compound Name | N-(3-chlorophenyl)-N'-pyrimidin-4-ylbut-2-enediamide |
|---|---|
| PubChem CID | 123515071 |
| Molecular Formula | C14H11ClN4O2 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-(3-chlorophenyl)-N'-pyrimidin-4-ylbut-2-enediamide |
| SMILES | O=C(C=CC(=O)Nc1ccncn1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H11ClN4O2/c15-10-2-1-3-11(8-10)18-13(20)4-5-14(21)19-12-6-7-16-9-17-12/h1-9H,(H,18,20)(H,16,17,19,21) |
| InChIKey | MLGIXQMDKZPTHG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|