C25H33N — CID 123515115
N-[2-(10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl)penta-1,3-dienyl]methanimine (PubChem CID 123515115) has the molecular formula C25H33N and a molecular weight of 347.55 g/mol. Its IUPAC name is N-[2-(10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl)penta-1,3-dienyl]methanimine.
| Compound Name | N-[2-(10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 123515115 |
| Molecular Formula | C25H33N |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | N-[2-(10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl)penta-1,3-dienyl]methanimine |
| SMILES | C=NC=C(C=CC)C1=CCC2C3CC=C4C=CCCC4(C)C3CCC12C |
| InChI | InChI=1S/C25H33N/c1-5-8-18(17-26-4)21-12-13-22-20-11-10-19-9-6-7-15-24(19,2)23(20)14-16-25(21,22)3/h5-6,8-10,12,17,20,22-23H,4,7,11,13-16H2,1-3H3 |
| InChIKey | MCRNJKVYBCRLDR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|