C19H31F3O6 — CID 123515196
(2-oxooxolan-3-yl) 2,2-dimethylbutanoate;1,1,1-trifluoropropan-2-yl 2,2-dimethylbutanoate (PubChem CID 123515196) has the molecular formula C19H31F3O6 and a molecular weight of 412.45 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 2,2-dimethylbutanoate;1,1,1-trifluoropropan-2-yl 2,2-dimethylbutanoate.
| Compound Name | (2-oxooxolan-3-yl) 2,2-dimethylbutanoate;1,1,1-trifluoropropan-2-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 123515196 |
| Molecular Formula | C19H31F3O6 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2-oxooxolan-3-yl) 2,2-dimethylbutanoate;1,1,1-trifluoropropan-2-yl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C)C(F)(F)F.CCC(C)(C)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C10H16O4.C9H15F3O2/c1-4-10(2,3)9(12)14-7-5-6-13-8(7)11;1-5-8(3,4)7(13)14-6(2)9(10,11)12/h7H,4-6H2,1-3H3;6H,5H2,1-4H3 |
| InChIKey | BYEMEOYXINTTJW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|