C19H23NO3 — CID 123515310
methyl 3-[5-(furan-3-yl)hexa-1,3,5-trien-2-yl]-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 123515310) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is methyl 3-[5-(furan-3-yl)hexa-1,3,5-trien-2-yl]-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl 3-[5-(furan-3-yl)hexa-1,3,5-trien-2-yl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 123515310 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | methyl 3-[5-(furan-3-yl)hexa-1,3,5-trien-2-yl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | C=C(C=CC(=C)C1CC2CCC(N2)C1C(=O)OC)c1ccoc1 |
| InChI | InChI=1S/C19H23NO3/c1-12(14-8-9-23-11-14)4-5-13(2)16-10-15-6-7-17(20-15)18(16)19(21)22-3/h4-5,8-9,11,15-18,20H,1-2,6-7,10H2,3H3 |
| InChIKey | QFKLEIJZPUVMNR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|