About 4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine
4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine (PubChem CID 123515438) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine.
Analyze 4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine?
The IUPAC name of 4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine (CID 123515438) is 4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine.
What is the SMILES notation for 4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine?
The canonical SMILES for 4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine is CC=CC1=C(C)CCNC1.
What is the InChIKey of 4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine?
The InChIKey is SXDGTPDAJXQFMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-3-4-9-7-10-6-5-8(9)2/h3-4,10H,5-7H2,1-2H3.
What are the key properties of 4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine?
4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine has a molecular weight of 137.23 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-prop-1-enyl-1,2,3,6-tetrahydropyridine is sourced from PubChem (CID 123515438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).