C38H35ClFN5O2 — CID 123515646
methyl 3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-5-fluoro-4-pyridinyl]amino]-4,4-dimethylpentanoate (PubChem CID 123515646) has the molecular formula C38H35ClFN5O2 and a molecular weight of 648.18 g/mol. Its IUPAC name is methyl 3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-5-fluoro-4-pyridinyl]amino]-4,4-dimethylpentanoate.
| Compound Name | methyl 3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-5-fluoro-4-pyridinyl]amino]-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 123515646 |
| Molecular Formula | C38H35ClFN5O2 |
| Molecular Weight | 648.18 g/mol |
| Exact Mass | 647.25 |
| IUPAC Name | methyl 3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-5-fluoro-4-pyridinyl]amino]-4,4-dimethylpentanoate |
| SMILES | COC(=O)CC(Nc1cc(-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ncc(Cl)nc23)ncc1F)C(C)(C)C |
| InChI | InChI=1S/C38H35ClFN5O2/c1-37(2,3)32(21-34(46)47-4)43-31-20-30(41-22-29(31)40)28-24-45(36-35(28)44-33(39)23-42-36)38(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-20,22-24,32H,21H2,1-4H3,(H,41,43) |
| InChIKey | CAAVQBPSNDVCFY-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.18 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|