C24H28F3N3O4 — CID 123516478
2-oxobutyl 4-[4-[6-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]piperazin-1-yl]butanoate (PubChem CID 123516478) has the molecular formula C24H28F3N3O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is 2-oxobutyl 4-[4-[6-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]piperazin-1-yl]butanoate.
| Compound Name | 2-oxobutyl 4-[4-[6-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 123516478 |
| Molecular Formula | C24H28F3N3O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 2-oxobutyl 4-[4-[6-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]piperazin-1-yl]butanoate |
| SMILES | CCC(=O)COC(=O)CCCN1CCN(c2cccc(-c3ccc(OC(F)(F)F)cc3)n2)CC1 |
| InChI | InChI=1S/C24H28F3N3O4/c1-2-19(31)17-33-23(32)7-4-12-29-13-15-30(16-14-29)22-6-3-5-21(28-22)18-8-10-20(11-9-18)34-24(25,26)27/h3,5-6,8-11H,2,4,7,12-17H2,1H3 |
| InChIKey | AWYPOALMBDPRNU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |