C23H30N2 — CID 1235168
2-N,4-N-bis(2,4,6-trimethylphenyl)pentane-2,4-diimine (PubChem CID 1235168) has the molecular formula C23H30N2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 2-N,4-N-bis(2,4,6-trimethylphenyl)pentane-2,4-diimine.
| Compound Name | 2-N,4-N-bis(2,4,6-trimethylphenyl)pentane-2,4-diimine |
|---|---|
| PubChem CID | 1235168 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 2-N,4-N-bis(2,4,6-trimethylphenyl)pentane-2,4-diimine |
| SMILES | C/C(C/C(C)=N/c1c(C)cc(C)cc1C)=N\c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C23H30N2/c1-14-9-16(3)22(17(4)10-14)24-20(7)13-21(8)25-23-18(5)11-15(2)12-19(23)6/h9-12H,13H2,1-8H3/b24-20+,25-21+ |
| InChIKey | BQPOGAGYMSGBNZ-CTWPWMDCSA-N |
| XLogP | 6.81 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|