C11H21NS — CID 123516968
3-(2,3-dimethylbut-3-enyl)-4-methyl-1,3-thiazinane (PubChem CID 123516968) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is 3-(2,3-dimethylbut-3-enyl)-4-methyl-1,3-thiazinane.
| Compound Name | 3-(2,3-dimethylbut-3-enyl)-4-methyl-1,3-thiazinane |
|---|---|
| PubChem CID | 123516968 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 3-(2,3-dimethylbut-3-enyl)-4-methyl-1,3-thiazinane |
| SMILES | C=C(C)C(C)CN1CSCCC1C |
| InChI | InChI=1S/C11H21NS/c1-9(2)10(3)7-12-8-13-6-5-11(12)4/h10-11H,1,5-8H2,2-4H3 |
| InChIKey | AOHHOECWLVIWRI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|