About 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol
3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol (PubChem CID 123517193) has the molecular formula C31H43N5O
and a molecular weight of 501.72 g/mol. Its IUPAC name is 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol.
Molecular Properties
| Compound Name | 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol |
| PubChem CID | 123517193 |
| Molecular Formula | C31H43N5O |
| Molecular Weight | 501.72 g/mol |
| Exact Mass | 501.35 |
| IUPAC Name | 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol |
| SMILES | C/C=C/c1c(N)c(Nc2ccc(N(CC)C(C)C)cc2)cc(Nc2ccc(N(CC)C(C)C)cc2)c1O |
| InChI | InChI=1S/C31H43N5O/c1-8-11-27-30(32)28(33-23-12-16-25(17-13-23)35(9-2)21(4)5)20-29(31(27)37)34-24-14-18-26(19-15-24)36(10-3)22(6)7/h8,11-22,33-34,37H,9-10,32H2,1-7H3/b11-8+ |
| InChIKey | RLJVRODIOSZCPG-DHZHZOJOSA-N |
| XLogP | 7.96 |
| TPSA | 76.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.72 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol?
The IUPAC name of 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol (CID 123517193) is 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol.
What is the SMILES notation for 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol?
The canonical SMILES for 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol is C/C=C/c1c(N)c(Nc2ccc(N(CC)C(C)C)cc2)cc(Nc2ccc(N(CC)C(C)C)cc2)c1O.
What is the InChIKey of 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol?
The InChIKey is RLJVRODIOSZCPG-DHZHZOJOSA-N. The full InChI is InChI=1S/C31H43N5O/c1-8-11-27-30(32)28(33-23-12-16-25(17-13-23)35(9-2)21(4)5)20-29(31(27)37)34-24-14-18-26(19-15-24)36(10-3)22(6)7/h8,11-22,33-34,37H,9-10,32H2,1-7H3/b11-8+.
What are the key properties of 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol?
3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol has a molecular weight of 501.72 g/mol, XLogP of 7.96, 11 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,6-bis[4-[ethyl(propan-2-yl)amino]anilino]-2-[(E)-prop-1-enyl]phenol is sourced from PubChem (CID 123517193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).