C32H46ClN5O3Si — CID 123517377
tert-butyl N-[1-[15-chloro-6-methanimidoyl-14-[2-tri(propan-2-yl)silylethynyl]-9-oxa-8,11,13-triazatricyclo[10.3.1.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-10-yl]ethyl]-N-methylcarbamate (PubChem CID 123517377) has the molecular formula C32H46ClN5O3Si and a molecular weight of 612.29 g/mol. Its IUPAC name is tert-butyl N-[1-[15-chloro-6-methanimidoyl-14-[2-tri(propan-2-yl)silylethynyl]-9-oxa-8,11,13-triazatricyclo[10.3.1.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-10-yl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[15-chloro-6-methanimidoyl-14-[2-tri(propan-2-yl)silylethynyl]-9-oxa-8,11,13-triazatricyclo[10.3.1.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-10-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123517377 |
| Molecular Formula | C32H46ClN5O3Si |
| Molecular Weight | 612.29 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | tert-butyl N-[1-[15-chloro-6-methanimidoyl-14-[2-tri(propan-2-yl)silylethynyl]-9-oxa-8,11,13-triazatricyclo[10.3.1.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-10-yl]ethyl]-N-methylcarbamate |
| SMILES | [H]/N=C/c1cccc2c1NOC(C(C)N(C)C(=O)OC(C)(C)C)Nc1cc-2c(Cl)c(C#C[Si](C(C)C)(C(C)C)C(C)C)n1 |
| InChI | InChI=1S/C32H46ClN5O3Si/c1-19(2)42(20(3)4,21(5)6)16-15-26-28(33)25-17-27(35-26)36-30(22(7)38(11)31(39)40-32(8,9)10)41-37-29-23(18-34)13-12-14-24(25)29/h12-14,17-22,30,34,37H,1-11H3,(H,35,36)/b34-18+ |
| InChIKey | NCEAPLIOULWMSY-FABQOPTDSA-N |
| XLogP | 8.32 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.29 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|