C21H40O3S — CID 123518376
S-(2,3-dihydroxypropyl) 2,2,4,4,7,7,9,9-octamethyldec-5-enethioate (PubChem CID 123518376) has the molecular formula C21H40O3S and a molecular weight of 372.62 g/mol. Its IUPAC name is S-(2,3-dihydroxypropyl) 2,2,4,4,7,7,9,9-octamethyldec-5-enethioate.
| Compound Name | S-(2,3-dihydroxypropyl) 2,2,4,4,7,7,9,9-octamethyldec-5-enethioate |
|---|---|
| PubChem CID | 123518376 |
| Molecular Formula | C21H40O3S |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | S-(2,3-dihydroxypropyl) 2,2,4,4,7,7,9,9-octamethyldec-5-enethioate |
| SMILES | CC(C)(C)CC(C)(C)C=CC(C)(C)CC(C)(C)C(=O)SCC(O)CO |
| InChI | InChI=1S/C21H40O3S/c1-18(2,3)14-19(4,5)10-11-20(6,7)15-21(8,9)17(24)25-13-16(23)12-22/h10-11,16,22-23H,12-15H2,1-9H3 |
| InChIKey | SJMQSNWTVCUYEV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|