C26H25BFNO3S — CID 123518536
1-(benzenesulfinyl)-2-(2-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 123518536) has the molecular formula C26H25BFNO3S and a molecular weight of 461.37 g/mol. Its IUPAC name is 1-(benzenesulfinyl)-2-(2-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 1-(benzenesulfinyl)-2-(2-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 123518536 |
| Molecular Formula | C26H25BFNO3S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 1-(benzenesulfinyl)-2-(2-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CC1(C)OB(c2ccc3c(c2)cc(-c2ccccc2F)n3S(=O)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C26H25BFNO3S/c1-25(2)26(3,4)32-27(31-25)19-14-15-23-18(16-19)17-24(21-12-8-9-13-22(21)28)29(23)33(30)20-10-6-5-7-11-20/h5-17H,1-4H3 |
| InChIKey | LBTNQFQYWHWYGW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|