About 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine
3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine (PubChem CID 123518736) has the molecular formula C8H19N3
and a molecular weight of 157.26 g/mol. Its IUPAC name is 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine.
Molecular Properties
| Compound Name | 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine |
| PubChem CID | 123518736 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine |
| SMILES | CC(C)CCC1NNC(C)N1 |
| InChI | InChI=1S/C8H19N3/c1-6(2)4-5-8-9-7(3)10-11-8/h6-11H,4-5H2,1-3H3 |
| InChIKey | WDMNXBFXYPEYIJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine?
The IUPAC name of 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine (CID 123518736) is 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine.
What is the SMILES notation for 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine?
The canonical SMILES for 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine is CC(C)CCC1NNC(C)N1.
What is the InChIKey of 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine?
The InChIKey is WDMNXBFXYPEYIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N3/c1-6(2)4-5-8-9-7(3)10-11-8/h6-11H,4-5H2,1-3H3.
What are the key properties of 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine?
3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine has a molecular weight of 157.26 g/mol, XLogP of 0.79, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-(3-methylbutyl)-1,2,4-triazolidine is sourced from PubChem (CID 123518736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).