C16H25ClFN3 — CID 123519620
4-[6-(3-chloro-6-fluorocyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]piperidin-2-amine (PubChem CID 123519620) has the molecular formula C16H25ClFN3 and a molecular weight of 313.85 g/mol. Its IUPAC name is 4-[6-(3-chloro-6-fluorocyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]piperidin-2-amine.
| Compound Name | 4-[6-(3-chloro-6-fluorocyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]piperidin-2-amine |
|---|---|
| PubChem CID | 123519620 |
| Molecular Formula | C16H25ClFN3 |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 4-[6-(3-chloro-6-fluorocyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]piperidin-2-amine |
| SMILES | NC1CC(C2=CCCNC2C2C=C(Cl)CCC2F)CCN1 |
| InChI | InChI=1S/C16H25ClFN3/c17-11-3-4-14(18)13(9-11)16-12(2-1-6-21-16)10-5-7-20-15(19)8-10/h2,9-10,13-16,20-21H,1,3-8,19H2 |
| InChIKey | YWHYXQWZNHMXDT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|